Organophosphorus compounds
eMolecules 787618-22-8 | 2-Dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl | Chem-Impex | MFCD06798294 | 466.646 | C30H43O2P | 98.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 1g | 449074997
2-Dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl | Chem-Impex | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2P | 98.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 1g | 449074997
eMolecules 4559-70-0 | Diphenylphosphine oxide | ChemScene | MFCD00002079 | 202.193 | C12H11OP | 95.000 | O=P(c1ccccc1)c1ccccc1 | 25g | 486160268
Diphenylphosphine oxide | ChemScene | 4559-70-0 | MFCD00002079 | 202.193 | C12H11OP | 95.000 | O=P(c1ccccc1)c1ccccc1 | 25g | 486160268
eMolecules 51805-45-9 | Tris(2-carboxyethyl)phosphine hydrochloride | Apollo Scientific US | MFCD00145469 | 286.640 | C9H16ClO6P | 98.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 5g | 870070003
Tris(2-carboxyethyl)phosphine hydrochloride | Apollo Scientific US | 51805-45-9 | MFCD00145469 | 286.640 | C9H16ClO6P | 98.000 | Cl.OC(=O)CCP(CCC(O)=O)CCC(O)=O | 5g | 870070003
eMolecules 1599466-81-5 | XPHOS PD G4 | AstaTech | MFCD28411652 | 860.490 | C47H64NO3PPdS | 95.000 | CS([O-])(=O)=O.CNc1ccccc1-c1ccccc1[Pd+].CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 449762969
XPHOS PD G4 | AstaTech | 1599466-81-5 | MFCD28411652 | 860.490 | C47H64NO3PPdS | 95.000 | CS([O-])(=O)=O.CNc1ccccc1-c1ccccc1[Pd+].CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 449762969
eMolecules 1160861-53-9 | 2-(Di-t-butylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl | Oakwood Chemical | MFCD13181930 | 484.705 | C31H49O2P | 97.000 | COc1ccc(OC)c(c1P(C(C)(C)C)C(C)(C)C)-c1c(cc(cc1C(C)C)C(C)C)C(C)C | 1g | 791206902
2-(Di-t-butylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl | Oakwood Chemical | 1160861-53-9 | MFCD13181930 | 484.705 | C31H49O2P | 97.000 | COc1ccc(OC)c(c1P(C(C)(C)C)C(C)(C)C)-c1c(cc(cc1C(C)C)C(C)C)C(C)C | 1g | 791206902
Strem, An Ascensus Company CAS# 29934-17-6. 1g. trans-Dichlorobis(tricyclohexylphosphine)palladium(II), 99%. MFCD00191830
CAS# 29934-17-6. 1g. trans-Dichlorobis(tricyclohexylphosphine)palladium(II), 99%. MFCD00191830. Molecular Weight: 738.19. Molecular Formula: PdCl2[(C6H11)3P]2. Color/form: light yellow pwdr. Strem# 46-0520. http://www.strem.com/catalog/v/46-0520/
eMolecules 564483-18-7 | 2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl | Accela ChemBio (ASD) | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 10g | 447990920
2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl | Accela ChemBio (ASD) | 564483-18-7 | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 10g | 447990920
eMolecules 338800-13-8 | 2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% | Strem Chemicals | MFCD10565623 | 395.552 | C23H43NP2 | 99.000 | CC(C)(C)P(Cc1cccc(CP(C(C)(C)C)C(C)(C)C)n1)C(C)(C)C | 1g | 321335592
2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99% | Strem Chemicals | 338800-13-8 | MFCD10565623 | 395.552 | C23H43NP2 | 99.000 | CC(C)(C)P(Cc1cccc(CP(C(C)(C)C)C(C)(C)C)n1)C(C)(C)C | 1g | 321335592
![eMolecules 281666-44-2 | (2S,4S)-1-(BENZYLOXYCARBONYL)-4-(TERT-BUTOXYCARBONYLAMINO)PYRROLIDINE-2-CARBOXYLIC ACID | AstaTech364.398 | C18H24N2O6 | 95.000 | CC(C)(C)OC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCc1ccccc1)C(O)=O | 0.25g | 490832527](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502471916.JPG-250.jpg)
eMolecules 281666-44-2 | (2S,4S)-1-(BENZYLOXYCARBONYL)-4-(TERT-BUTOXYCARBONYLAMINO)PYRROLIDINE-2-CARBOXYLIC ACID | AstaTech364.398 | C18H24N2O6 | 95.000 | CC(C)(C)OC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCc1ccccc1)C(O)=O | 0.25g | 490832527
(2S,4S)-1-(BENZYLOXYCARBONYL)-4-(TERT-BUTOXYCARBONYLAMINO)PYRROLIDINE-2-CARBOXYLIC ACID | AstaTech | 281666-44-2364.398 | C18H24N2O6 | 95.000 | CC(C)(C)OC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCc1ccccc1)C(O)=O | 0.25g | 490832527
eMolecules 564483-18-7 | 2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl | Accela ChemBio (ASD) | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 444756112
2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl | Accela ChemBio (ASD) | 564483-18-7 | MFCD04117682 | 476.729 | C33H49P | 97.000 | CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 444756112
Cambridge Isotope Laboratories 1 2 3 8 9-PentaCDF (unlabeled) 25 ng/mL in nonane 0 2 mL
1 2 3 8 9-PentaCDF (unlabeled) 25 ng/mL in nonane 0 2 mL
Strem, An Ascensus Company CAS# 870245-84-4. 2g. 2'-Dicyclohexylphosphino-2,6-di-i-propyl-4-sulfonato-1,1'-biphenyl hydrate sodium salt (XPhos-SO3Na). MFCD09265103
CAS# 870245-84-4. 2g. 2'-Dicyclohexylphosphino-2,6-di-i-propyl-4-sulfonato-1,1'-biphenyl hydrate sodium salt (XPhos-SO3Na). MFCD09265103. Molecular Weight: 536.68. Molecular Formula: C30H42NaO3PS·;XH2O. Color/form: beige solid Strem# 15-1135. http://www.strem.com/catalog/v/15-1135/
eMolecules 1091606-70-0 | (1R,2R)-2-(Diphenylphosphino)-2,3-dihydro-1H-inden-1-amine | MFCD17013983 | 1g
AbaChemScene | tert-Butyl (E)-4-(2-(4455-tetramethyl-132-dioxaborolan-2-yl)vinyl)piperidine-1-carboxylate | 100mg | 410745130 | CS-0037397 | 1160924-51-5 | MFCD28388343 | 337.270 | C18H32BNO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Strem, An Ascensus Company CAS# 6476-36-4. 5g. Tri-i-propylphosphine, 98%. MFCD00015029
CAS# 6476-36-4. 5g. Tri-i-propylphosphine, 98%. MFCD00015029. Molecular Weight: 160.24. Molecular Formula: (i-C3H7)3P. Color/form: colorless liq. Strem# 15-6950. http://www.strem.com/catalog/v/15-6950/
Accela Chembio Inc 1 | 3-bis(diphenylphosphino)propane Nickel (ii) Chloride | 50g | 15629-92-2 | MFCD00015318 | 98% | Shelf Life: 1260 Days | N2/+4
1 | 3-bis(diphenylphosphino)propane Nickel (ii) Chloride | 50g | 15629-92-2 | MFCD00015318 | 98% | Shelf Life: 1260 Days | N2/+4